C15H18ClN6O4+ — CID 59002335
2-amino-6-chloro-9-[(1-hydroxy-4,6-dimethoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7H-purin-8-one (PubChem CID 59002335) has the molecular formula C15H18ClN6O4+ and a molecular weight of 381.80 g/mol. Its IUPAC name is 2-amino-6-chloro-9-[(1-hydroxy-4,6-dimethoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7H-purin-8-one.
| Compound Name | 2-amino-6-chloro-9-[(1-hydroxy-4,6-dimethoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 59002335 |
| Molecular Formula | C15H18ClN6O4+ |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-amino-6-chloro-9-[(1-hydroxy-4,6-dimethoxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]-7H-purin-8-one |
| SMILES | COc1c(C)c(Cn2c(=O)[nH]c3c(Cl)nc(N)nc32)[n+](O)c(OC)c1C |
| InChI | InChI=1S/C15H17ClN6O4/c1-6-8(22(24)13(26-4)7(2)10(6)25-3)5-21-12-9(18-15(21)23)11(16)19-14(17)20-12/h5H2,1-4H3,(H3-,17,18,19,20,23,24)/p+1 |
| InChIKey | PBFIHOUESRAHRN-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|