C7H7Cl2N5O — CID 142671065
2-(2-amino-6,8-dichloropurin-9-yl)ethanol (PubChem CID 142671065) has the molecular formula C7H7Cl2N5O and a molecular weight of 248.07 g/mol. Its IUPAC name is 2-(2-amino-6,8-dichloropurin-9-yl)ethanol.
| Compound Name | 2-(2-amino-6,8-dichloropurin-9-yl)ethanol |
|---|---|
| PubChem CID | 142671065 |
| Molecular Formula | C7H7Cl2N5O |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 2-(2-amino-6,8-dichloropurin-9-yl)ethanol |
| SMILES | Nc1nc(Cl)c2nc(Cl)n(CCO)c2n1 |
| InChI | InChI=1S/C7H7Cl2N5O/c8-4-3-5(13-7(10)12-4)14(1-2-15)6(9)11-3/h15H,1-2H2,(H2,10,12,13) |
| InChIKey | OHDACZHEBQKRPY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |