C12H8Cl3N5S — CID 162767093
2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-7H-purine-8-thione (PubChem CID 162767093) has the molecular formula C12H8Cl3N5S and a molecular weight of 360.66 g/mol. Its IUPAC name is 2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-7H-purine-8-thione.
| Compound Name | 2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-7H-purine-8-thione |
|---|---|
| PubChem CID | 162767093 |
| Molecular Formula | C12H8Cl3N5S |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-7H-purine-8-thione |
| SMILES | Nc1nc(Cl)c2[nH]c(=S)n(Cc3ccc(Cl)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C12H8Cl3N5S/c13-6-2-1-5(3-7(6)14)4-20-10-8(17-12(20)21)9(15)18-11(16)19-10/h1-3H,4H2,(H,17,21)(H2,16,18,19) |
| InChIKey | PQXHMWQOPLWHOH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|