C18H19BrCl3N5O — CID 165147114
2-amino-7-(6-bromohexyl)-6-chloro-9-[(3,4-dichlorophenyl)methyl]purin-8-one (PubChem CID 165147114) has the molecular formula C18H19BrCl3N5O and a molecular weight of 507.65 g/mol. Its IUPAC name is 2-amino-7-(6-bromohexyl)-6-chloro-9-[(3,4-dichlorophenyl)methyl]purin-8-one.
| Compound Name | 2-amino-7-(6-bromohexyl)-6-chloro-9-[(3,4-dichlorophenyl)methyl]purin-8-one |
|---|---|
| PubChem CID | 165147114 |
| Molecular Formula | C18H19BrCl3N5O |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 504.98 |
| IUPAC Name | 2-amino-7-(6-bromohexyl)-6-chloro-9-[(3,4-dichlorophenyl)methyl]purin-8-one |
| SMILES | Nc1nc(Cl)c2c(n1)n(Cc1ccc(Cl)c(Cl)c1)c(=O)n2CCCCCCBr |
| InChI | InChI=1S/C18H19BrCl3N5O/c19-7-3-1-2-4-8-26-14-15(22)24-17(23)25-16(14)27(18(26)28)10-11-5-6-12(20)13(21)9-11/h5-6,9H,1-4,7-8,10H2,(H2,23,24,25) |
| InChIKey | GTOQXTJXNCPXHA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|