C39H40BrClFN5O4P+ — CID 172684508
6-[2-amino-9-[(4-bromo-2-fluorophenyl)methyl]-6-chloro-8-oxopurin-7-yl]hexyl-tris(4-methoxyphenyl)phosphanium (PubChem CID 172684508) has the molecular formula C39H40BrClFN5O4P+ and a molecular weight of 808.11 g/mol. Its IUPAC name is 6-[2-amino-9-[(4-bromo-2-fluorophenyl)methyl]-6-chloro-8-oxopurin-7-yl]hexyl-tris(4-methoxyphenyl)phosphanium.
| Compound Name | 6-[2-amino-9-[(4-bromo-2-fluorophenyl)methyl]-6-chloro-8-oxopurin-7-yl]hexyl-tris(4-methoxyphenyl)phosphanium |
|---|---|
| PubChem CID | 172684508 |
| Molecular Formula | C39H40BrClFN5O4P+ |
| Molecular Weight | 808.11 g/mol |
| Exact Mass | 806.17 |
| IUPAC Name | 6-[2-amino-9-[(4-bromo-2-fluorophenyl)methyl]-6-chloro-8-oxopurin-7-yl]hexyl-tris(4-methoxyphenyl)phosphanium |
| SMILES | COc1ccc([P+](CCCCCCn2c(=O)n(Cc3ccc(Br)cc3F)c3nc(N)nc(Cl)c32)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H40BrClFN5O4P/c1-49-28-10-16-31(17-11-28)52(32-18-12-29(50-2)13-19-32,33-20-14-30(51-3)15-21-33)23-7-5-4-6-22-46-35-36(41)44-38(43)45-37(35)47(39(46)48)25-26-8-9-27(40)24-34(26)42/h8-21,24H,4-7,22-23,25H2,1-3H3,(H2,43,44,45)/q+1 |
| InChIKey | AVVDBSCNHHPIBC-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.11 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|