C18H18Cl3N5O3 — CID 165147119
methyl 5-[2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-8-oxopurin-7-yl]pentanoate (PubChem CID 165147119) has the molecular formula C18H18Cl3N5O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is methyl 5-[2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-8-oxopurin-7-yl]pentanoate.
| Compound Name | methyl 5-[2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-8-oxopurin-7-yl]pentanoate |
|---|---|
| PubChem CID | 165147119 |
| Molecular Formula | C18H18Cl3N5O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | methyl 5-[2-amino-6-chloro-9-[(3,4-dichlorophenyl)methyl]-8-oxopurin-7-yl]pentanoate |
| SMILES | COC(=O)CCCCn1c(=O)n(Cc2ccc(Cl)c(Cl)c2)c2nc(N)nc(Cl)c21 |
| InChI | InChI=1S/C18H18Cl3N5O3/c1-29-13(27)4-2-3-7-25-14-15(21)23-17(22)24-16(14)26(18(25)28)9-10-5-6-11(19)12(20)8-10/h5-6,8H,2-4,7,9H2,1H3,(H2,22,23,24) |
| InChIKey | BUSGTSLCQDTCAS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|