About 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one
6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one (PubChem CID 130448363) has the molecular formula C15H15Cl2N5OS
and a molecular weight of 384.29 g/mol. Its IUPAC name is 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one.
Molecular Properties
| Compound Name | 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one |
| PubChem CID | 130448363 |
| Molecular Formula | C15H15Cl2N5OS |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one |
| SMILES | CC(C)c1nc(N)c2c(n1)n(Cc1ccc(Cl)c(Cl)c1)c(=O)n2S |
| InChI | InChI=1S/C15H15Cl2N5OS/c1-7(2)13-19-12(18)11-14(20-13)21(15(23)22(11)24)6-8-3-4-9(16)10(17)5-8/h3-5,7,24H,6H2,1-2H3,(H2,18,19,20) |
| InChIKey | ZUQVSNULKSQSKZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one?
The IUPAC name of 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one (CID 130448363) is 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one.
What is the SMILES notation for 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one?
The canonical SMILES for 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one is CC(C)c1nc(N)c2c(n1)n(Cc1ccc(Cl)c(Cl)c1)c(=O)n2S.
What is the InChIKey of 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one?
The InChIKey is ZUQVSNULKSQSKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N5OS/c1-7(2)13-19-12(18)11-14(20-13)21(15(23)22(11)24)6-8-3-4-9(16)10(17)5-8/h3-5,7,24H,6H2,1-2H3,(H2,18,19,20).
What are the key properties of 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one?
6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one has a molecular weight of 384.29 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-propan-2-yl-7-sulfanylpurin-8-one is sourced from PubChem (CID 130448363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).