C23H23ClFN5O2S — CID 130448340
9-[(4-chloro-3-fluorophenyl)methyl]-6-[1-(4-methoxy-N-methylanilino)propan-2-yl]-7-sulfanylpurin-8-one (PubChem CID 130448340) has the molecular formula C23H23ClFN5O2S and a molecular weight of 487.99 g/mol. Its IUPAC name is 9-[(4-chloro-3-fluorophenyl)methyl]-6-[1-(4-methoxy-N-methylanilino)propan-2-yl]-7-sulfanylpurin-8-one.
| Compound Name | 9-[(4-chloro-3-fluorophenyl)methyl]-6-[1-(4-methoxy-N-methylanilino)propan-2-yl]-7-sulfanylpurin-8-one |
|---|---|
| PubChem CID | 130448340 |
| Molecular Formula | C23H23ClFN5O2S |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 9-[(4-chloro-3-fluorophenyl)methyl]-6-[1-(4-methoxy-N-methylanilino)propan-2-yl]-7-sulfanylpurin-8-one |
| SMILES | COc1ccc(N(C)CC(C)c2ncnc3c2n(S)c(=O)n3Cc2ccc(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C23H23ClFN5O2S/c1-14(11-28(2)16-5-7-17(32-3)8-6-16)20-21-22(27-13-26-20)29(23(31)30(21)33)12-15-4-9-18(24)19(25)10-15/h4-10,13-14,33H,11-12H2,1-3H3 |
| InChIKey | UAXQRETWOBIPLF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|