C16H20Cl2N4O2 — CID 171984270
5-amino-1-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)-2-methylimidazole-4-carboxamide (PubChem CID 171984270) has the molecular formula C16H20Cl2N4O2 and a molecular weight of 371.27 g/mol. Its IUPAC name is 5-amino-1-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)-2-methylimidazole-4-carboxamide.
| Compound Name | 5-amino-1-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)-2-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 171984270 |
| Molecular Formula | C16H20Cl2N4O2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 5-amino-1-[(3,4-dichlorophenyl)methyl]-N-(3-methoxypropyl)-2-methylimidazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1nc(C)n(Cc2ccc(Cl)c(Cl)c2)c1N |
| InChI | InChI=1S/C16H20Cl2N4O2/c1-10-21-14(16(23)20-6-3-7-24-2)15(19)22(10)9-11-4-5-12(17)13(18)8-11/h4-5,8H,3,6-7,9,19H2,1-2H3,(H,20,23) |
| InChIKey | KGZAPRMTMSJELO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|