C26H20Cl2N4O2 — CID 3974517
3,7-dibenzyl-1-[(3,4-dichlorophenyl)methyl]purine-2,6-dione (PubChem CID 3974517) has the molecular formula C26H20Cl2N4O2 and a molecular weight of 491.38 g/mol. Its IUPAC name is 3,7-dibenzyl-1-[(3,4-dichlorophenyl)methyl]purine-2,6-dione.
| Compound Name | 3,7-dibenzyl-1-[(3,4-dichlorophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 3974517 |
| Molecular Formula | C26H20Cl2N4O2 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 3,7-dibenzyl-1-[(3,4-dichlorophenyl)methyl]purine-2,6-dione |
| SMILES | O=c1c2c(ncn2Cc2ccccc2)n(Cc2ccccc2)c(=O)n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N4O2/c27-21-12-11-20(13-22(21)28)16-32-25(33)23-24(29-17-30(23)14-18-7-3-1-4-8-18)31(26(32)34)15-19-9-5-2-6-10-19/h1-13,17H,14-16H2 |
| InChIKey | RGIIDYATMPTJBO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |