C25H19FN4O2 — CID 46061280
1-benzyl-7-[(3-fluorophenyl)methyl]-3-phenylpurine-2,6-dione (PubChem CID 46061280) has the molecular formula C25H19FN4O2 and a molecular weight of 426.45 g/mol. Its IUPAC name is 1-benzyl-7-[(3-fluorophenyl)methyl]-3-phenylpurine-2,6-dione.
| Compound Name | 1-benzyl-7-[(3-fluorophenyl)methyl]-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 46061280 |
| Molecular Formula | C25H19FN4O2 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-benzyl-7-[(3-fluorophenyl)methyl]-3-phenylpurine-2,6-dione |
| SMILES | O=c1c2c(ncn2Cc2cccc(F)c2)n(-c2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H19FN4O2/c26-20-11-7-10-19(14-20)15-28-17-27-23-22(28)24(31)29(16-18-8-3-1-4-9-18)25(32)30(23)21-12-5-2-6-13-21/h1-14,17H,15-16H2 |
| InChIKey | UWSARJYHEGQGLM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |