C21H20N4O2 — CID 46047354
1-ethyl-7-[(3-methylphenyl)methyl]-3-phenylpurine-2,6-dione (PubChem CID 46047354) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-ethyl-7-[(3-methylphenyl)methyl]-3-phenylpurine-2,6-dione.
| Compound Name | 1-ethyl-7-[(3-methylphenyl)methyl]-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 46047354 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-ethyl-7-[(3-methylphenyl)methyl]-3-phenylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2cccc(C)c2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H20N4O2/c1-3-24-20(26)18-19(25(21(24)27)17-10-5-4-6-11-17)22-14-23(18)13-16-9-7-8-15(2)12-16/h4-12,14H,3,13H2,1-2H3 |
| InChIKey | NBLWVZUGCNTQOU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |