C22H22N4O4 — CID 42853191
1-ethyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione (PubChem CID 42853191) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-ethyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione.
| Compound Name | 1-ethyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 42853191 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-ethyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2cccc(OC)c2)n(-c2cccc(OC)c2)c1=O |
| InChI | InChI=1S/C22H22N4O4/c1-4-25-21(27)19-20(26(22(25)28)16-8-6-10-18(12-16)30-3)23-14-24(19)13-15-7-5-9-17(11-15)29-2/h5-12,14H,4,13H2,1-3H3 |
| InChIKey | YXOMGIWKCRRFGZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |