C24H24N4O4 — CID 42862989
7-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione (PubChem CID 42862989) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 7-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione.
| Compound Name | 7-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 42862989 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 7-[(3-methoxyphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione |
| SMILES | COc1cccc(Cn2cnc3c2c(=O)n(CC2CCCO2)c(=O)n3-c2ccccc2)c1 |
| InChI | InChI=1S/C24H24N4O4/c1-31-19-10-5-7-17(13-19)14-26-16-25-22-21(26)23(29)27(15-20-11-6-12-32-20)24(30)28(22)18-8-3-2-4-9-18/h2-5,7-10,13,16,20H,6,11-12,14-15H2,1H3 |
| InChIKey | DUXBLIRLXCEJFW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |