C24H23N5O5 — CID 92990612
3-(2-methylphenyl)-7-[(3-nitrophenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]purine-2,6-dione (PubChem CID 92990612) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-(2-methylphenyl)-7-[(3-nitrophenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]purine-2,6-dione.
| Compound Name | 3-(2-methylphenyl)-7-[(3-nitrophenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 92990612 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 3-(2-methylphenyl)-7-[(3-nitrophenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]purine-2,6-dione |
| SMILES | Cc1ccccc1-n1c(=O)n(C[C@@H]2CCCO2)c(=O)c2c1ncn2Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23N5O5/c1-16-6-2-3-10-20(16)28-22-21(23(30)27(24(28)31)14-19-9-5-11-34-19)26(15-25-22)13-17-7-4-8-18(12-17)29(32)33/h2-4,6-8,10,12,15,19H,5,9,11,13-14H2,1H3/t19-/m0/s1 |
| InChIKey | UKUBYPDDJWWQOR-IBGZPJMESA-N |
| XLogP | 2.79 |
| TPSA | 114.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|