C24H24N4O3 — CID 42862766
7-[(4-methylphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione (PubChem CID 42862766) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 7-[(4-methylphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione.
| Compound Name | 7-[(4-methylphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 42862766 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 7-[(4-methylphenyl)methyl]-1-(oxolan-2-ylmethyl)-3-phenylpurine-2,6-dione |
| SMILES | Cc1ccc(Cn2cnc3c2c(=O)n(CC2CCCO2)c(=O)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c1-17-9-11-18(12-10-17)14-26-16-25-22-21(26)23(29)27(15-20-8-5-13-31-20)24(30)28(22)19-6-3-2-4-7-19/h2-4,6-7,9-12,16,20H,5,8,13-15H2,1H3 |
| InChIKey | VFPCJHSVWJQRDK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |