C27H24N4O4 — CID 46061582
1-benzyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione (PubChem CID 46061582) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is 1-benzyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione.
| Compound Name | 1-benzyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 46061582 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1-benzyl-3-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]purine-2,6-dione |
| SMILES | COc1cccc(Cn2cnc3c2c(=O)n(Cc2ccccc2)c(=O)n3-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C27H24N4O4/c1-34-22-12-6-10-20(14-22)16-29-18-28-25-24(29)26(32)30(17-19-8-4-3-5-9-19)27(33)31(25)21-11-7-13-23(15-21)35-2/h3-15,18H,16-17H2,1-2H3 |
| InChIKey | CNOATAHEPMQADZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |