C26H21ClN4O2 — CID 42862810
1-benzyl-3-(4-chlorophenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione (PubChem CID 42862810) has the molecular formula C26H21ClN4O2 and a molecular weight of 456.93 g/mol. Its IUPAC name is 1-benzyl-3-(4-chlorophenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 1-benzyl-3-(4-chlorophenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 42862810 |
| Molecular Formula | C26H21ClN4O2 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-benzyl-3-(4-chlorophenyl)-7-[(3-methylphenyl)methyl]purine-2,6-dione |
| SMILES | Cc1cccc(Cn2cnc3c2c(=O)n(Cc2ccccc2)c(=O)n3-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C26H21ClN4O2/c1-18-6-5-9-20(14-18)15-29-17-28-24-23(29)25(32)30(16-19-7-3-2-4-8-19)26(33)31(24)22-12-10-21(27)11-13-22/h2-14,17H,15-16H2,1H3 |
| InChIKey | ZEIYSSOQENPSBQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |