C26H21N5O4 — CID 42863008
1-benzyl-3-(3-methylphenyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione (PubChem CID 42863008) has the molecular formula C26H21N5O4 and a molecular weight of 467.49 g/mol. Its IUPAC name is 1-benzyl-3-(3-methylphenyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione.
| Compound Name | 1-benzyl-3-(3-methylphenyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 42863008 |
| Molecular Formula | C26H21N5O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-benzyl-3-(3-methylphenyl)-7-[(4-nitrophenyl)methyl]purine-2,6-dione |
| SMILES | Cc1cccc(-n2c(=O)n(Cc3ccccc3)c(=O)c3c2ncn3Cc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C26H21N5O4/c1-18-6-5-9-22(14-18)30-24-23(25(32)29(26(30)33)16-19-7-3-2-4-8-19)28(17-27-24)15-20-10-12-21(13-11-20)31(34)35/h2-14,17H,15-16H2,1H3 |
| InChIKey | AEYPOLJGRLSKII-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|