C26H20FN5O5 — CID 46061825
3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]-7-[(3-nitrophenyl)methyl]purine-2,6-dione (PubChem CID 46061825) has the molecular formula C26H20FN5O5 and a molecular weight of 501.47 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]-7-[(3-nitrophenyl)methyl]purine-2,6-dione.
| Compound Name | 3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]-7-[(3-nitrophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 46061825 |
| Molecular Formula | C26H20FN5O5 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]-7-[(3-nitrophenyl)methyl]purine-2,6-dione |
| SMILES | COc1ccc(Cn2c(=O)c3c(ncn3Cc3cccc([N+](=O)[O-])c3)n(-c3ccc(F)cc3)c2=O)cc1 |
| InChI | InChI=1S/C26H20FN5O5/c1-37-22-11-5-17(6-12-22)15-30-25(33)23-24(31(26(30)34)20-9-7-19(27)8-10-20)28-16-29(23)14-18-3-2-4-21(13-18)32(35)36/h2-13,16H,14-15H2,1H3 |
| InChIKey | MWAJDGGAOGANLM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 114.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|