C27H23FN4O4 — CID 46061059
3-(4-fluorophenyl)-1,7-bis[(4-methoxyphenyl)methyl]purine-2,6-dione (PubChem CID 46061059) has the molecular formula C27H23FN4O4 and a molecular weight of 486.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1,7-bis[(4-methoxyphenyl)methyl]purine-2,6-dione.
| Compound Name | 3-(4-fluorophenyl)-1,7-bis[(4-methoxyphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 46061059 |
| Molecular Formula | C27H23FN4O4 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-(4-fluorophenyl)-1,7-bis[(4-methoxyphenyl)methyl]purine-2,6-dione |
| SMILES | COc1ccc(Cn2c(=O)c3c(ncn3Cc3ccc(OC)cc3)n(-c3ccc(F)cc3)c2=O)cc1 |
| InChI | InChI=1S/C27H23FN4O4/c1-35-22-11-3-18(4-12-22)15-30-17-29-25-24(30)26(33)31(16-19-5-13-23(36-2)14-6-19)27(34)32(25)21-9-7-20(28)8-10-21/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | GFVOYPCEPAYCHL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |