C21H17N5O4 — CID 42853089
7-[(3-nitrophenyl)methyl]-3-phenyl-1-prop-2-enylpurine-2,6-dione (PubChem CID 42853089) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is 7-[(3-nitrophenyl)methyl]-3-phenyl-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 7-[(3-nitrophenyl)methyl]-3-phenyl-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 42853089 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 7-[(3-nitrophenyl)methyl]-3-phenyl-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2Cc2cccc([N+](=O)[O-])c2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H17N5O4/c1-2-11-24-20(27)18-19(25(21(24)28)16-8-4-3-5-9-16)22-14-23(18)13-15-7-6-10-17(12-15)26(29)30/h2-10,12,14H,1,11,13H2 |
| InChIKey | NMPLJGNDXFLYOD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|