C23H19FN4O4 — CID 46158868
methyl 3-[[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]methyl]benzoate (PubChem CID 46158868) has the molecular formula C23H19FN4O4 and a molecular weight of 434.43 g/mol. Its IUPAC name is methyl 3-[[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]methyl]benzoate |
|---|---|
| PubChem CID | 46158868 |
| Molecular Formula | C23H19FN4O4 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | methyl 3-[[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]methyl]benzoate |
| SMILES | C=CCn1c(=O)c2c(ncn2Cc2cccc(C(=O)OC)c2)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C23H19FN4O4/c1-3-11-27-21(29)19-20(28(23(27)31)18-9-7-17(24)8-10-18)25-14-26(19)13-15-5-4-6-16(12-15)22(30)32-2/h3-10,12,14H,1,11,13H2,2H3 |
| InChIKey | KTXOUUYTQIWBBV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|