C19H19FN4O4 — CID 93329532
ethyl (2S)-2-[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate (PubChem CID 93329532) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is ethyl (2S)-2-[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate.
| Compound Name | ethyl (2S)-2-[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate |
|---|---|
| PubChem CID | 93329532 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | ethyl (2S)-2-[3-(4-fluorophenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate |
| SMILES | C=CCn1c(=O)c2c(ncn2[C@@H](C)C(=O)OCC)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C19H19FN4O4/c1-4-10-22-17(25)15-16(21-11-23(15)12(3)18(26)28-5-2)24(19(22)27)14-8-6-13(20)7-9-14/h4,6-9,11-12H,1,5,10H2,2-3H3/t12-/m0/s1 |
| InChIKey | GLLYOTCBODICET-LBPRGKRZSA-N |
| XLogP | 1.80 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|