C19H22N4O4 — CID 93329572
ethyl (2R)-2-[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]propanoate (PubChem CID 93329572) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl (2R)-2-[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]propanoate.
| Compound Name | ethyl (2R)-2-[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]propanoate |
|---|---|
| PubChem CID | 93329572 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | ethyl (2R)-2-[1-ethyl-3-(4-methylphenyl)-2,6-dioxopurin-7-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)n1cnc2c1c(=O)n(CC)c(=O)n2-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22N4O4/c1-5-21-17(24)15-16(20-11-22(15)13(4)18(25)27-6-2)23(19(21)26)14-9-7-12(3)8-10-14/h7-11,13H,5-6H2,1-4H3/t13-/m1/s1 |
| InChIKey | JFZHVEZKJKHWSW-CYBMUJFWSA-N |
| XLogP | 1.80 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |