C18H19FN4O4 — CID 46047030
ethyl 2-[1-ethyl-3-(3-fluorophenyl)-2,6-dioxopurin-7-yl]propanoate (PubChem CID 46047030) has the molecular formula C18H19FN4O4 and a molecular weight of 374.37 g/mol. Its IUPAC name is ethyl 2-[1-ethyl-3-(3-fluorophenyl)-2,6-dioxopurin-7-yl]propanoate.
| Compound Name | ethyl 2-[1-ethyl-3-(3-fluorophenyl)-2,6-dioxopurin-7-yl]propanoate |
|---|---|
| PubChem CID | 46047030 |
| Molecular Formula | C18H19FN4O4 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl 2-[1-ethyl-3-(3-fluorophenyl)-2,6-dioxopurin-7-yl]propanoate |
| SMILES | CCOC(=O)C(C)n1cnc2c1c(=O)n(CC)c(=O)n2-c1cccc(F)c1 |
| InChI | InChI=1S/C18H19FN4O4/c1-4-21-16(24)14-15(20-10-22(14)11(3)17(25)27-5-2)23(18(21)26)13-8-6-7-12(19)9-13/h6-11H,4-5H2,1-3H3 |
| InChIKey | WLMJTYLYDCLNCL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |