C21H28N6O2 — CID 135481016
2-anilino-9-[4-(3-methoxypiperidin-1-yl)butyl]-1H-purin-6-one (PubChem CID 135481016) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-anilino-9-[4-(3-methoxypiperidin-1-yl)butyl]-1H-purin-6-one.
| Compound Name | 2-anilino-9-[4-(3-methoxypiperidin-1-yl)butyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135481016 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-anilino-9-[4-(3-methoxypiperidin-1-yl)butyl]-1H-purin-6-one |
| SMILES | COC1CCCN(CCCCn2cnc3c(=O)[nH]c(Nc4ccccc4)nc32)C1 |
| InChI | InChI=1S/C21H28N6O2/c1-29-17-10-7-12-26(14-17)11-5-6-13-27-15-22-18-19(27)24-21(25-20(18)28)23-16-8-3-2-4-9-16/h2-4,8-9,15,17H,5-7,10-14H2,1H3,(H2,23,24,25,28) |
| InChIKey | HDYMZDLRTYUGIJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|