C22H30N6O2 — CID 135421348
2-anilino-9-[4-[2-(2-hydroxyethyl)piperidin-1-yl]butyl]-1H-purin-6-one (PubChem CID 135421348) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-anilino-9-[4-[2-(2-hydroxyethyl)piperidin-1-yl]butyl]-1H-purin-6-one.
| Compound Name | 2-anilino-9-[4-[2-(2-hydroxyethyl)piperidin-1-yl]butyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135421348 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-anilino-9-[4-[2-(2-hydroxyethyl)piperidin-1-yl]butyl]-1H-purin-6-one |
| SMILES | O=c1[nH]c(Nc2ccccc2)nc2c1ncn2CCCCN1CCCCC1CCO |
| InChI | InChI=1S/C22H30N6O2/c29-15-11-18-10-4-5-12-27(18)13-6-7-14-28-16-23-19-20(28)25-22(26-21(19)30)24-17-8-2-1-3-9-17/h1-3,8-9,16,18,29H,4-7,10-15H2,(H2,24,25,26,30) |
| InChIKey | ATXXEVMPCXMMTG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|