C20H26N6O2 — CID 135440411
2-anilino-9-[4-(4-hydroxypiperidin-1-yl)butyl]-1H-purin-6-one (PubChem CID 135440411) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-anilino-9-[4-(4-hydroxypiperidin-1-yl)butyl]-1H-purin-6-one.
| Compound Name | 2-anilino-9-[4-(4-hydroxypiperidin-1-yl)butyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135440411 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-anilino-9-[4-(4-hydroxypiperidin-1-yl)butyl]-1H-purin-6-one |
| SMILES | O=c1[nH]c(Nc2ccccc2)nc2c1ncn2CCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C20H26N6O2/c27-16-8-12-25(13-9-16)10-4-5-11-26-14-21-17-18(26)23-20(24-19(17)28)22-15-6-2-1-3-7-15/h1-3,6-7,14,16,27H,4-5,8-13H2,(H2,22,23,24,28) |
| InChIKey | YYSHQMGCZBTZSN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|