C19H22N4O5 — CID 97499622
ethyl (2R)-2-[1-ethyl-3-(3-methoxyphenyl)-2,6-dioxopurin-7-yl]propanoate (PubChem CID 97499622) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is ethyl (2R)-2-[1-ethyl-3-(3-methoxyphenyl)-2,6-dioxopurin-7-yl]propanoate.
| Compound Name | ethyl (2R)-2-[1-ethyl-3-(3-methoxyphenyl)-2,6-dioxopurin-7-yl]propanoate |
|---|---|
| PubChem CID | 97499622 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | ethyl (2R)-2-[1-ethyl-3-(3-methoxyphenyl)-2,6-dioxopurin-7-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)n1cnc2c1c(=O)n(CC)c(=O)n2-c1cccc(OC)c1 |
| InChI | InChI=1S/C19H22N4O5/c1-5-21-17(24)15-16(20-11-22(15)12(3)18(25)28-6-2)23(19(21)26)13-8-7-9-14(10-13)27-4/h7-12H,5-6H2,1-4H3/t12-/m1/s1 |
| InChIKey | FEGRWRDDRRYKKG-GFCCVEGCSA-N |
| XLogP | 1.50 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |