C20H22N4O5 — CID 93329663
ethyl (2R)-2-[3-(3-methoxyphenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate (PubChem CID 93329663) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl (2R)-2-[3-(3-methoxyphenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate.
| Compound Name | ethyl (2R)-2-[3-(3-methoxyphenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate |
|---|---|
| PubChem CID | 93329663 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | ethyl (2R)-2-[3-(3-methoxyphenyl)-2,6-dioxo-1-prop-2-enylpurin-7-yl]propanoate |
| SMILES | C=CCn1c(=O)c2c(ncn2[C@H](C)C(=O)OCC)n(-c2cccc(OC)c2)c1=O |
| InChI | InChI=1S/C20H22N4O5/c1-5-10-22-18(25)16-17(21-12-23(16)13(3)19(26)29-6-2)24(20(22)27)14-8-7-9-15(11-14)28-4/h5,7-9,11-13H,1,6,10H2,2-4H3/t13-/m1/s1 |
| InChIKey | DWGLPQINGLJJTD-CYBMUJFWSA-N |
| XLogP | 1.67 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|