C22H19FN4O3 — CID 46047663
7-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-prop-2-enylpurine-2,6-dione (PubChem CID 46047663) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is 7-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 7-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 46047663 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 7-[(3-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2Cc2cccc(F)c2)n(-c2cccc(OC)c2)c1=O |
| InChI | InChI=1S/C22H19FN4O3/c1-3-10-26-21(28)19-20(24-14-25(19)13-15-6-4-7-16(23)11-15)27(22(26)29)17-8-5-9-18(12-17)30-2/h3-9,11-12,14H,1,10,13H2,2H3 |
| InChIKey | ZYTRVPHDWDJCBJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|