C23H19ClN4O4 — CID 46061318
3-(3-chlorophenyl)-7-[2-(3-methoxyphenyl)-2-oxoethyl]-1-prop-2-enylpurine-2,6-dione (PubChem CID 46061318) has the molecular formula C23H19ClN4O4 and a molecular weight of 450.88 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-7-[2-(3-methoxyphenyl)-2-oxoethyl]-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 3-(3-chlorophenyl)-7-[2-(3-methoxyphenyl)-2-oxoethyl]-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 46061318 |
| Molecular Formula | C23H19ClN4O4 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-(3-chlorophenyl)-7-[2-(3-methoxyphenyl)-2-oxoethyl]-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(ncn2CC(=O)c2cccc(OC)c2)n(-c2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C23H19ClN4O4/c1-3-10-27-22(30)20-21(28(23(27)31)17-8-5-7-16(24)12-17)25-14-26(20)13-19(29)15-6-4-9-18(11-15)32-2/h3-9,11-12,14H,1,10,13H2,2H3 |
| InChIKey | OOJCUNGVEHSSGJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|