C12H16N4O4 — CID 26433996
ethyl (2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate (PubChem CID 26433996) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is ethyl (2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate.
| Compound Name | ethyl (2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate |
|---|---|
| PubChem CID | 26433996 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | ethyl (2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate |
| SMILES | CCOC(=O)[C@H](C)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H16N4O4/c1-5-20-11(18)7(2)16-6-13-9-8(16)10(17)15(4)12(19)14(9)3/h6-7H,5H2,1-4H3/t7-/m0/s1 |
| InChIKey | HYRISXJXPAFJIK-ZETCQYMHSA-N |
| XLogP | -0.44 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |