C10H11ClN4O3 — CID 123768598
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoyl chloride (PubChem CID 123768598) has the molecular formula C10H11ClN4O3 and a molecular weight of 270.68 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoyl chloride.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoyl chloride |
|---|---|
| PubChem CID | 123768598 |
| Molecular Formula | C10H11ClN4O3 |
| Molecular Weight | 270.68 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoyl chloride |
| SMILES | CC(C(=O)Cl)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H11ClN4O3/c1-5(7(11)16)15-4-12-8-6(15)9(17)14(3)10(18)13(8)2/h4-5H,1-3H3 |
| InChIKey | AKXHSAKCCNMMCQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.68 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|