C18H20N6O4 — CID 7856269
(2R)-N-(4-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide (PubChem CID 7856269) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is (2R)-N-(4-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide.
| Compound Name | (2R)-N-(4-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
|---|---|
| PubChem CID | 7856269 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (2R)-N-(4-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)n2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C18H20N6O4/c1-10(16(26)21-13-7-5-12(6-8-13)20-11(2)25)24-9-19-15-14(24)17(27)23(4)18(28)22(15)3/h5-10H,1-4H3,(H,20,25)(H,21,26)/t10-/m1/s1 |
| InChIKey | KXMIDRXBNPXAJH-SNVBAGLBSA-N |
| XLogP | 0.59 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |