C16H15F2N5O3 — CID 51237383
N-(2,6-difluorophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide (PubChem CID 51237383) has the molecular formula C16H15F2N5O3 and a molecular weight of 363.32 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
|---|---|
| PubChem CID | 51237383 |
| Molecular Formula | C16H15F2N5O3 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
| SMILES | CC(C(=O)Nc1c(F)cccc1F)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H15F2N5O3/c1-8(14(24)20-11-9(17)5-4-6-10(11)18)23-7-19-13-12(23)15(25)22(3)16(26)21(13)2/h4-8H,1-3H3,(H,20,24) |
| InChIKey | CYXUUIHJHYICBQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |