C22H21N5O4 — CID 4805058
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-phenoxyphenyl)propanamide (PubChem CID 4805058) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-phenoxyphenyl)propanamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 4805058 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-phenoxyphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(Oc2ccccc2)cc1)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C22H21N5O4/c1-14(27-13-23-19-18(27)21(29)26(3)22(30)25(19)2)20(28)24-15-9-11-17(12-10-15)31-16-7-5-4-6-8-16/h4-14H,1-3H3,(H,24,28) |
| InChIKey | KDQVRQNMGZARKD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |