C10H12N4O4 — CID 118471919
(2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid (PubChem CID 118471919) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is (2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid.
| Compound Name | (2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid |
|---|---|
| PubChem CID | 118471919 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid |
| SMILES | C[C@H](C(=O)O)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H12N4O4/c1-5(9(16)17)14-4-11-7-6(14)8(15)13(3)10(18)12(7)2/h4-5H,1-3H3,(H,16,17)/t5-/m1/s1 |
| InChIKey | VKZUUXKUXANENJ-RXMQYKEDSA-N |
| XLogP | -0.92 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |