C10H14F2N4O2 — CID 145188712
7-(difluoromethyl)-1,3-dimethylpurine-2,6-dione;ethane (PubChem CID 145188712) has the molecular formula C10H14F2N4O2 and a molecular weight of 260.24 g/mol. Its IUPAC name is 7-(difluoromethyl)-1,3-dimethylpurine-2,6-dione;ethane.
| Compound Name | 7-(difluoromethyl)-1,3-dimethylpurine-2,6-dione;ethane |
|---|---|
| PubChem CID | 145188712 |
| Molecular Formula | C10H14F2N4O2 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 7-(difluoromethyl)-1,3-dimethylpurine-2,6-dione;ethane |
| SMILES | CC.Cn1c(=O)c2c(ncn2C(F)F)n(C)c1=O |
| InChI | InChI=1S/C8H8F2N4O2.C2H6/c1-12-5-4(6(15)13(2)8(12)16)14(3-11-5)7(9)10;1-2/h3,7H,1-2H3;1-2H3 |
| InChIKey | TZLXIHVDVGYCNO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |