C16H16N4O4 — CID 23455185
1-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl benzoate (PubChem CID 23455185) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl benzoate.
| Compound Name | 1-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl benzoate |
|---|---|
| PubChem CID | 23455185 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl benzoate |
| SMILES | CC(OC(=O)c1ccccc1)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H16N4O4/c1-10(24-15(22)11-7-5-4-6-8-11)20-9-17-13-12(20)14(21)19(3)16(23)18(13)2/h4-10H,1-3H3 |
| InChIKey | PTPJNYBLCFFZIH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |