C17H18N4O4 — CID 40661292
ethyl (2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-phenylacetate (PubChem CID 40661292) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is ethyl (2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-phenylacetate.
| Compound Name | ethyl (2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 40661292 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | ethyl (2R)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](c1ccccc1)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H18N4O4/c1-4-25-16(23)12(11-8-6-5-7-9-11)21-10-18-14-13(21)15(22)20(3)17(24)19(14)2/h5-10,12H,4H2,1-3H3/t12-/m1/s1 |
| InChIKey | XYISYVHJMODRFA-GFCCVEGCSA-N |
| XLogP | 0.59 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |