C23H19N5O3 — CID 60535854
7-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 60535854) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 7-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 60535854 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 7-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C(C(=O)c2c[nH]c3ccccc23)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C23H19N5O3/c1-26-21-19(22(30)27(2)23(26)31)28(13-25-21)18(14-8-4-3-5-9-14)20(29)16-12-24-17-11-7-6-10-15(16)17/h3-13,18,24H,1-2H3 |
| InChIKey | ZVPGGMFFOXPHKR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |