C27H23N3O2S — CID 3443150
2-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]sulfanyl-3-propylquinazolin-4-one (PubChem CID 3443150) has the molecular formula C27H23N3O2S and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]sulfanyl-3-propylquinazolin-4-one.
| Compound Name | 2-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]sulfanyl-3-propylquinazolin-4-one |
|---|---|
| PubChem CID | 3443150 |
| Molecular Formula | C27H23N3O2S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]sulfanyl-3-propylquinazolin-4-one |
| SMILES | CCCn1c(SC(C(=O)c2c[nH]c3ccccc23)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H23N3O2S/c1-2-16-30-26(32)20-13-7-9-15-23(20)29-27(30)33-25(18-10-4-3-5-11-18)24(31)21-17-28-22-14-8-6-12-19(21)22/h3-15,17,25,28H,2,16H2,1H3 |
| InChIKey | RLTFBLOCHUJTPY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |