C23H22N4O3 — CID 40713064
7-[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 40713064) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 7-[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 40713064 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 7-[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1ccc(C(=O)[C@@H](c2ccc(C)cc2)n2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-14-5-9-16(10-6-14)18(20(28)17-11-7-15(2)8-12-17)27-13-24-21-19(27)22(29)26(4)23(30)25(21)3/h5-13,18H,1-4H3/t18-/m1/s1 |
| InChIKey | APEGNRNRLCHOEE-GOSISDBHSA-N |
| XLogP | 2.52 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |