C23H23N5O4 — CID 40792378
(2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)-2-phenylacetamide (PubChem CID 40792378) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is (2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 40792378 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2S)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)-2-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H](c1ccccc1)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H23N5O4/c1-4-32-17-13-9-8-12-16(17)25-21(29)18(15-10-6-5-7-11-15)28-14-24-20-19(28)22(30)27(3)23(31)26(20)2/h5-14,18H,4H2,1-3H3,(H,25,29)/t18-/m0/s1 |
| InChIKey | UGAKRVYBSWLNOW-SFHVURJKSA-N |
| XLogP | 2.06 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |