C14H21N5O3 — CID 51237378
N-tert-butyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide (PubChem CID 51237378) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-tert-butyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide.
| Compound Name | N-tert-butyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
|---|---|
| PubChem CID | 51237378 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-tert-butyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
| SMILES | CC(C(=O)NC(C)(C)C)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H21N5O3/c1-8(11(20)16-14(2,3)4)19-7-15-10-9(19)12(21)18(6)13(22)17(10)5/h7-8H,1-6H3,(H,16,20) |
| InChIKey | SRFXGRCRFAURGX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |