C16H14Cl3N5O3 — CID 16534950
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 16534950) has the molecular formula C16H14Cl3N5O3 and a molecular weight of 430.68 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 16534950 |
| Molecular Formula | C16H14Cl3N5O3 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)c(Cl)cc1Cl)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H14Cl3N5O3/c1-7(14(25)21-11-5-9(18)8(17)4-10(11)19)24-6-20-13-12(24)15(26)23(3)16(27)22(13)2/h4-7H,1-3H3,(H,21,25) |
| InChIKey | LRRHBIHWASOQNE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|