C21H16FN5O2 — CID 46062036
3-[[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile (PubChem CID 46062036) has the molecular formula C21H16FN5O2 and a molecular weight of 389.39 g/mol. Its IUPAC name is 3-[[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile.
| Compound Name | 3-[[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 46062036 |
| Molecular Formula | C21H16FN5O2 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-[[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]methyl]benzonitrile |
| SMILES | CCn1c(=O)c2c(ncn2Cc2cccc(C#N)c2)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C21H16FN5O2/c1-2-26-20(28)18-19(27(21(26)29)17-8-6-16(22)7-9-17)24-13-25(18)12-15-5-3-4-14(10-15)11-23/h3-10,13H,2,12H2,1H3 |
| InChIKey | KDJOOACWHQNVOK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |