About 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione
7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione (PubChem CID 46047031) has the molecular formula C20H15F3N4O2
and a molecular weight of 400.36 g/mol. Its IUPAC name is 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione |
| PubChem CID | 46047031 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(ncn2Cc2ccc(F)c(F)c2)n(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C20H15F3N4O2/c1-2-26-19(28)17-18(27(20(26)29)14-5-3-4-13(21)9-14)24-11-25(17)10-12-6-7-15(22)16(23)8-12/h3-9,11H,2,10H2,1H3 |
| InChIKey | RUUWDFCIEDXYPR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione?
The IUPAC name of 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione (CID 46047031) is 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione.
What is the SMILES notation for 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione?
The canonical SMILES for 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione is CCn1c(=O)c2c(ncn2Cc2ccc(F)c(F)c2)n(-c2cccc(F)c2)c1=O.
What is the InChIKey of 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione?
The InChIKey is RUUWDFCIEDXYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3N4O2/c1-2-26-19(28)17-18(27(20(26)29)14-5-3-4-13(21)9-14)24-11-25(17)10-12-6-7-15(22)16(23)8-12/h3-9,11H,2,10H2,1H3.
What are the key properties of 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione?
7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione has a molecular weight of 400.36 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3,4-difluorophenyl)methyl]-1-ethyl-3-(3-fluorophenyl)purine-2,6-dione is sourced from PubChem (CID 46047031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).